ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
73960-07-3 4-(Difluoromethoxy)benzaldehyde |
|
produktnavn | 4-(Difluoromethoxy)benzaldehyde |
Engelsk navn | 4-(Difluoromethoxy)benzaldehyde;p-(Difluoromethoxy)benzaldehyde |
Molekylær Formel | C8H6F2O2 |
Molekylvekt | 172.1288 |
InChI | InChI=1/C8H6F2O2/c9-8(10)12-7-3-1-6(5-11)2-4-7/h1-5,8H |
CAS-nummer | 73960-07-3 |
EINECS | 277-653-5 |
Molecular Structure | ![]() |
Tetthet | 1.262g/cm3 |
Kokepunkt | 234.7°C at 760 mmHg |
Brytningsindeks | 1.497 |
Flammepunktet | 93.1°C |
Damptrykk | 0.0522mmHg at 25°C |
Hazard symboler | |
Risiko Koder | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Sikkerhet Beskrivelse | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |