ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
75014-23-2 fosforodittiosyre, O-(4-brom-2-klorfenyl) O-etyl S-propylester |
|
| produktnavn | fosforodittiosyre, O-(4-brom-2-klorfenyl) O-etyl S-propylester |
| Engelsk navn | phosphorodithioic acid, O-(4-bromo-2-chlorophenyl) O-ethyl S-propyl ester; |
| Molekylær Formel | C11H15BrClO2PS2 |
| Molekylvekt | 389.6964 |
| InChI | InChI=1/C11H15BrClO2PS2/c1-3-7-18-16(17,14-4-2)15-11-6-5-9(12)8-10(11)13/h5-6,8H,3-4,7H2,1-2H3 |
| CAS-nummer | 75014-23-2 |
| Molecular Structure | ![]() |
| Tetthet | 1.499g/cm3 |
| Kokepunkt | 410.15°C at 760 mmHg |
| Brytningsindeks | 1.592 |
| Flammepunktet | 201.852°C |
| Damptrykk | 0mmHg at 25°C |
| MSDS | |