ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
76-54-0 2',7'-Dichlorofluorescein |
|
| produktnavn | 2',7'-Dichlorofluorescein |
| Engelsk navn | 2',7'-Dichlorofluorescein; |
| Molekylær Formel | C20H10Cl2O5 |
| Molekylvekt | 401.1964 |
| InChI | InChI=1/C20H10Cl2O5/c21-13-5-11-17(7-15(13)23)27-18-8-16(24)14(22)6-12(18)19(11)9-3-1-2-4-10(9)20(25)26/h1-8,23H,(H,25,26) |
| CAS-nummer | 76-54-0 |
| EINECS | 200-968-6 |
| Molecular Structure | ![]() |
| Tetthet | 1.68g/cm3 |
| Smeltepunkt | 280℃ |
| Kokepunkt | 670.7°C at 760 mmHg |
| Brytningsindeks | 1.757 |
| Flammepunktet | 359.4°C |
| Damptrykk | 6.63E-19mmHg at 25°C |
| Sikkerhet Beskrivelse | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |