ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
77-62-3 Methylenebismethylcyclohexylpcresol; 90% |
|
| produktnavn | Methylenebismethylcyclohexylpcresol; 90% |
| Engelsk navn | Methylenebismethylcyclohexylpcresol; 90%;Bis[2-hydroxy-5-methyl-3-(1-methylcyclohexyl)phenyl]methane;2,2-methylenebis(6-cyclohexyl-4-methylphenol);2,2-Methylenebis[6-(1-methylcyclohexyl)-p-cresol];2,2'-methanediylbis[4-methyl-6-(1-methylcyclohexyl)phenol] |
| Molekylær Formel | C29H40O2 |
| Molekylvekt | 420.6267 |
| InChI | InChI=1/C29H40O2/c1-20-15-22(26(30)24(17-20)28(3)11-7-5-8-12-28)19-23-16-21(2)18-25(27(23)31)29(4)13-9-6-10-14-29/h15-18,30-31H,5-14,19H2,1-4H3 |
| CAS-nummer | 77-62-3 |
| EINECS | 201-044-5 |
| Molecular Structure | ![]() |
| Tetthet | 1.058g/cm3 |
| Kokepunkt | 526.9°C at 760 mmHg |
| Brytningsindeks | 1.567 |
| Flammepunktet | 219.2°C |
| Damptrykk | 1.02E-11mmHg at 25°C |
| Sikkerhet Beskrivelse | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |