ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
816-73-9 2-metylallyl isobutyrat |
|
| produktnavn | 2-metylallyl isobutyrat |
| Synonymer | Propansyre, 2-metyl-, 2-metyl-2-propen-1-ylester; 2-metylallyl isobutyrat; Isosmørsyre, 2-metylallyl ester; Propansyre, 2-metyl-, 2-metyl-2-propenylester; 2-metylprop-2-en-1-yl 2-metylpropanoat; |
| Engelsk navn | 2-methylallyl isobutyrate;Propanoic acid, 2-methyl-, 2-methyl-2-propen-1-yl ester;2-Methylallyl isobutyrate;Isobutyric acid, 2-methylallyl ester;Propanoic acid, 2-methyl-, 2-methyl-2-propenyl ester;2-methylprop-2-en-1-yl 2-methylpropanoate |
| Molekylær Formel | C8H14O2 |
| Molekylvekt | 142.1956 |
| InChI | InChI=1/C8H14O2/c1-6(2)5-10-8(9)7(3)4/h7H,1,5H2,2-4H3 |
| CAS-nummer | 816-73-9 |
| EINECS | 212-437-6 |
| Molecular Structure | ![]() |
| Tetthet | 0.892g/cm3 |
| Kokepunkt | 164.3°C at 760 mmHg |
| Brytningsindeks | 1.421 |
| Flammepunktet | 59.9°C |
| Damptrykk | 1.98mmHg at 25°C |
| MSDS | |