ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-17-6 1,3-diguanidocyclohexane-2,4,5,6-tetrol |
|
| produktnavn | 1,3-diguanidocyclohexane-2,4,5,6-tetrol |
| Synonymer | ; streptidin; 2,2'-(2,4,5,6-tetrahydroksycykloheksan-1,3-diyl)diguanidin; 2,2'-[(1R,3S,4R,6S)-2,4,5,6-tetrahydroksycykloheksan-1,3-diyl]diguanidin; |
| Engelsk navn | 1,3-diguanidocyclohexane-2,4,5,6-tetrol;streptidine;2,2'-(2,4,5,6-tetrahydroxycyclohexane-1,3-diyl)diguanidine;2,2'-[(1R,3S,4R,6S)-2,4,5,6-tetrahydroxycyclohexane-1,3-diyl]diguanidine |
| Molekylær Formel | C8H18N6O4 |
| Molekylvekt | 262.2663 |
| InChI | InChI=1/C8H18N6O4/c9-7(10)13-1-3(15)2(14-8(11)12)5(17)6(18)4(1)16/h1-6,15-18H,(H4,9,10,13)(H4,11,12,14)/t1-,2+,3?,4+,5-,6? |
| CAS-nummer | 85-17-6 |
| Molecular Structure | ![]() |
| Tetthet | 2.21g/cm3 |
| Kokepunkt | 623.3°C at 760 mmHg |
| Brytningsindeks | 1.873 |
| Flammepunktet | 330.8°C |
| Damptrykk | 3.77E-18mmHg at 25°C |
| MSDS | |