ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
86-35-1 ethotoin |
|
| produktnavn | ethotoin |
| Engelsk navn | ethotoin;3-ethyl-5-phenylhydantoin;3-ethyl-5-phenylimidazolidine-2,4-dione |
| Molekylær Formel | C11H12N2O2 |
| Molekylvekt | 204.2252 |
| InChI | InChI=1/C11H12N2O2/c1-2-13-10(14)9(12-11(13)15)8-6-4-3-5-7-8/h3-7,9H,2H2,1H3,(H,12,15) |
| CAS-nummer | 86-35-1 |
| EINECS | 201-665-1 |
| Molecular Structure | ![]() |
| Tetthet | 1.197g/cm3 |
| Brytningsindeks | 1.555 |
| MSDS | |