ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
860197-83-7 4-klor-5,8-dimetyl-2-fenyl-kinolin |
|
| produktnavn | 4-klor-5,8-dimetyl-2-fenyl-kinolin |
| Synonymer | 4-klor-5,8-dimetyl-2-fenylkinolin; kinolin, 4-klor-5,8-dimetyl-2-fenyl- |
| Engelsk navn | 4-chloro-5,8-dimethyl-2-phenyl-quinoline;4-Chloro-5,8-dimethyl-2-phenylquinoline;quinoline, 4-chloro-5,8-dimethyl-2-phenyl- |
| Molekylær Formel | C17H14ClN |
| Molekylvekt | 267.75 |
| InChI | InChI=1/C17H14ClN/c1-11-8-9-12(2)17-16(11)14(18)10-15(19-17)13-6-4-3-5-7-13/h3-10H,1-2H3 |
| CAS-nummer | 860197-83-7 |
| Molecular Structure | ![]() |
| Tetthet | 1.181g/cm3 |
| Kokepunkt | 408.4°C at 760 mmHg |
| Brytningsindeks | 1.637 |
| Flammepunktet | 233.2°C |
| Damptrykk | 1.66E-06mmHg at 25°C |
| MSDS | |