ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-00-3 Homatropine |
|
| produktnavn | Homatropine |
| Engelsk navn | Homatropine;(RS)-3alpha(1alphaH,5alphaH)-Tropanylmandelat;3alpha-Tropylmandelat;5-21-01-00234 (Beilstein Handbook Reference);BRN 0087959;DL-Mandelsaeure-tropylester;Homatropin;Homoatropine;Homotropine;Mandelic acid, 3d-tropanyl ester;Mandelyltropeine;Mandelytropeine;Methylhomatropinum;Omatropina;Omatropina [DCIT];Tropine, mandelate (ester);Tropinmandelsaeureester;UNII-8QS6WCL55Z;1-alpha-H,5-alpha-H-Tropan-3-alpha-ol, mandelate (ester) |
| Molekylær Formel | C16H21NO3 |
| Molekylvekt | 275.34 |
| InChI | InChI=1/C16H21NO3/c1-17-12-7-8-13(17)10-14(9-12)20-16(19)15(18)11-5-3-2-4-6-11/h2-6,12-15,18H,7-10H2,1H3 |
| CAS-nummer | 87-00-3 |
| EINECS | 201-716-8 |
| Molecular Structure | ![]() |
| MSDS | |