ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-48-9 5-Bromoisatin monohydrate |
|
| produktnavn | 5-Bromoisatin monohydrate |
| Engelsk navn | 5-Bromoisatin monohydrate;5-bromoindoline-2,3-dione;5-Bromoisatine;5-bromo-1H-indole-2,3-dione;5-Bromoisatin;5-Bromoindole-2,3-dione |
| Molekylær Formel | C8H4BrNO2 |
| Molekylvekt | 226.0269 |
| InChI | InChI=1/C8H4BrNO2/c9-4-1-2-6-5(3-4)7(11)8(12)10-6/h1-3H,(H,10,11,12) |
| CAS-nummer | 87-48-9 |
| EINECS | 201-747-7 |
| Molecular Structure | ![]() |
| Tetthet | 1.826g/cm3 |
| Smeltepunkt | 251-253℃ |
| Brytningsindeks | 1.649 |
| Hazard symboler | |
| Risiko Koder | R37/38||R41:; |
| Sikkerhet Beskrivelse | S26||S37/39:; |
| MSDS | |