ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-74-1 D-glycero-D-gulo-heptonsyre |
|
| produktnavn | D-glycero-D-gulo-heptonsyre |
| Synonymer | ;D-glukoheptonsyre; |
| Engelsk navn | D-glycero-D-gulo-heptonic acid;D-glucoheptonic acid |
| Molekylær Formel | C7H14O8 |
| Molekylvekt | 226.1813 |
| InChI | InChI=1/C7H14O8/c8-1-2(9)3(10)4(11)5(12)6(13)7(14)15/h2-6,8-13H,1H2,(H,14,15)/t2-,3-,4+,5-,6-/m1/s1 |
| CAS-nummer | 87-74-1 |
| EINECS | 201-769-7 |
| Molecular Structure | ![]() |
| Tetthet | 1.8g/cm3 |
| Kokepunkt | 727.8°C at 760 mmHg |
| Brytningsindeks | 1.636 |
| Flammepunktet | 407.9°C |
| Damptrykk | 1.87E-24mmHg at 25°C |
| MSDS | |