ChemIndex - En gratis kjemisk CAS-databaseToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
948291-86-9 2,6-diklor-3-(2-kloretyl)-8-metyl-kinolin |
|
| produktnavn | 2,6-diklor-3-(2-kloretyl)-8-metyl-kinolin |
| Synonymer | ; 2,6-diklor-3-(2-kloretyl)-8-metylkinolin; kinolin, 2,6-diklor-3-(2-kloretyl)-8-metyl- |
| Engelsk navn | 2,6-dichloro-3-(2-chloroethyl)-8-methyl-quinoline;2,6-Dichloro-3-(2-chloroethyl)-8-methylquinoline;quinoline, 2,6-dichloro-3-(2-chloroethyl)-8-methyl- |
| Molekylær Formel | C12H10Cl3N |
| Molekylvekt | 274.5735 |
| InChI | InChI=1/C12H10Cl3N/c1-7-4-10(14)6-9-5-8(2-3-13)12(15)16-11(7)9/h4-6H,2-3H2,1H3 |
| CAS-nummer | 948291-86-9 |
| Molecular Structure | ![]() |
| Tetthet | 1.364g/cm3 |
| Kokepunkt | 387.3°C at 760 mmHg |
| Brytningsindeks | 1.625 |
| Flammepunktet | 220.1°C |
| Damptrykk | 7.41E-06mmHg at 25°C |
| MSDS | |