ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
104-18-7 (4-Aminophenylthio)acetic acid |
|
| Nazwa produktu: | (4-Aminophenylthio)acetic acid |
| Angielska nazwa | (4-Aminophenylthio)acetic acid;2-(4-Aminophenylthio)acetic acid;4-Aminothiophenoxyacetic acid;[(4-aminophenyl)sulfanyl]acetic acid;[(4-aminophenyl)sulfanyl]acetate |
| MF | C8H8NO2S |
| Masie cząsteczkowej | 182.2202 |
| InChI | InChI=1/C8H9NO2S/c9-6-1-3-7(4-2-6)12-5-8(10)11/h1-4H,5,9H2,(H,10,11)/p-1 |
| Nr CAS | 104-18-7 |
| EINECS | 203-182-1 |
| Struktury molekularnej | ![]() |
| Temperatura wrzenia | 405.3°C at 760 mmHg |
| Temperatura zapłonu | 198.9°C |
| Ciśnienie pary | 2.69E-07mmHg at 25°C |
| Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |