ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
218930-10-0 4-(2,6-dimethylmorpholino)aniline |
|
| Nazwa produktu: | 4-(2,6-dimethylmorpholino)aniline |
| Angielska nazwa | 4-(2,6-dimethylmorpholino)aniline;4-(2,6-dimethylmorpholin-4-yl)aniline |
| MF | C12H18N2O |
| Masie cząsteczkowej | 206.2841 |
| InChI | InChI=1/C12H18N2O/c1-9-7-14(8-10(2)15-9)12-5-3-11(13)4-6-12/h3-6,9-10H,7-8,13H2,1-2H3 |
| Nr CAS | 218930-10-0 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.057g/cm3 |
| Temperatura topnienia | 68℃ |
| Temperatura wrzenia | 370.2°C at 760 mmHg |
| Współczynnik załamania | 1.545 |
| Temperatura zapłonu | 177.7°C |
| Ciśnienie pary | 1.13E-05mmHg at 25°C |
| Symbole zagrożenia | |
| Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |