ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306935-88-6 3-bromo-4-fluoro-1,1'-biphenyl |
|
Nazwa produktu: | 3-bromo-4-fluoro-1,1'-biphenyl |
Angielska nazwa | 3-bromo-4-fluoro-1,1'-biphenyl;3-bromo-4-fluorobiphenyl |
MF | C12H8BrF |
Masie cząsteczkowej | 251.0943 |
InChI | InChI=1/C12H8BrF/c13-11-8-10(6-7-12(11)14)9-4-2-1-3-5-9/h1-8H |
Nr CAS | 306935-88-6 |
Struktury molekularnej | ![]() |
Gęstość | 1.433g/cm3 |
Temperatura wrzenia | 294.8°C at 760 mmHg |
Współczynnik załamania | 1.583 |
Temperatura zapłonu | 135.8°C |
Ciśnienie pary | 0.0028mmHg at 25°C |
Symbole zagrożenia | |
Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
MSDS |