ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
3460-49-9 4-Isothiocyanatophenetol |
|
Nazwa produktu: | 4-Isothiocyanatophenetol |
Angielska nazwa | 4-Isothiocyanatophenetol;4-Ethoxyphenyl isothiocyanate;1-ethoxy-4-isothiocyanatobenzene |
MF | C9H9NOS |
Masie cząsteczkowej | 179.2389 |
InChI | InChI=1/C9H9NOS/c1-2-11-9-5-3-8(4-6-9)10-7-12/h3-6H,2H2,1H3 |
Nr CAS | 3460-49-9 |
EINECS | 222-410-0 |
Struktury molekularnej | ![]() |
Gęstość | 1.06g/cm3 |
Temperatura wrzenia | 288.7°C at 760 mmHg |
Współczynnik załamania | 1.544 |
Temperatura zapłonu | 128.4°C |
Ciśnienie pary | 0.004mmHg at 25°C |
Kody ryzyka | R20/21/22##Harmful by inhalation, in contact with skin and if swallowed.||R36/37/38##Irritating to eyes, respiratory system and skin.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.:; |
MSDS |