ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
374538-04-2 4-Cyclohexylbenzeneboronic acid |
|
| Nazwa produktu: | 4-Cyclohexylbenzeneboronic acid |
| Angielska nazwa | 4-Cyclohexylbenzeneboronic acid;4-Cyclohexylphenylboronic acid |
| MF | C12H17BO2 |
| Masie cząsteczkowej | 204.0732 |
| InChI | InChI=1/C12H17BO2/c14-13(15)12-8-6-11(7-9-12)10-4-2-1-3-5-10/h6-10,14-15H,1-5H2 |
| Nr CAS | 374538-04-2 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.09g/cm3 |
| Temperatura wrzenia | 363.7°C at 760 mmHg |
| Współczynnik załamania | 1.543 |
| Temperatura zapłonu | 173.8°C |
| Ciśnienie pary | 6.29E-06mmHg at 25°C |
| Kody ryzyka | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |