ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4788-37-8 N-Benzyl-N-ethylmethylamine |
|
Nazwa produktu: | N-Benzyl-N-ethylmethylamine |
Angielska nazwa | N-Benzyl-N-ethylmethylamine;N-benzyl-N-methylethanamine |
MF | C10H15N |
Masie cząsteczkowej | 149.2328 |
InChI | InChI=1/C10H15N/c1-3-11(2)9-10-7-5-4-6-8-10/h4-8H,3,9H2,1-2H3 |
Nr CAS | 4788-37-8 |
Struktury molekularnej | ![]() |
Gęstość | 0.918g/cm3 |
Temperatura wrzenia | 187°C at 760 mmHg |
Współczynnik załamania | 1.512 |
Temperatura zapłonu | 59.4°C |
Ciśnienie pary | 0.645mmHg at 25°C |
Kody ryzyka | R34##Causes burns.:; |
Bezpieczeństwo opis | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
MSDS |