ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
57396-87-9 4'-chlorobiphenyl-4-yl acetate |
|
| Nazwa produktu: | 4'-chlorobiphenyl-4-yl acetate |
| Angielska nazwa | 4'-chlorobiphenyl-4-yl acetate;[1,1'-Biphenyl]-4-ol, 4'-chloro-, acetate;4'-Chloro[1,1'-biphenyl]-4-yl acetate |
| MF | C14H11ClO2 |
| Masie cząsteczkowej | 246.6889 |
| InChI | InChI=1/C14H11ClO2/c1-10(16)17-14-8-4-12(5-9-14)11-2-6-13(15)7-3-11/h2-9H,1H3 |
| Nr CAS | 57396-87-9 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.207g/cm3 |
| Temperatura wrzenia | 359.8°C at 760 mmHg |
| Współczynnik załamania | 1.57 |
| Temperatura zapłonu | 184.3°C |
| Ciśnienie pary | 2.32E-05mmHg at 25°C |
| MSDS | |