ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
82-98-4 piperidolate |
|
| Nazwa produktu: | piperidolate |
| Angielska nazwa | piperidolate;1-ethyl-3-piperidyl diphenylacetate;1-ethylpiperidin-3-yl diphenylacetate |
| MF | C21H25NO2 |
| Masie cząsteczkowej | 323.4287 |
| InChI | InChI=1/C21H25NO2/c1-2-22-15-9-14-19(16-22)24-21(23)20(17-10-5-3-6-11-17)18-12-7-4-8-13-18/h3-8,10-13,19-20H,2,9,14-16H2,1H3 |
| Nr CAS | 82-98-4 |
| EINECS | 201-449-7 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.11g/cm3 |
| Temperatura wrzenia | 431.9°C at 760 mmHg |
| Współczynnik załamania | 1.583 |
| Temperatura zapłonu | 136°C |
| Ciśnienie pary | 1.16E-07mmHg at 25°C |
| MSDS | |