ChemIndex - Bezpłatna baza danych CAS chemikaliówToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
88384-58-1 3',4',5',6'-tetrachloro-1,1':2',1''-terfenyl |
|
| Nazwa produktu: | 3',4',5',6'-tetrachloro-1,1':2',1''-terfenyl |
| Angielska nazwa | 3',4',5',6'-tetrachloro-1,1':2',1''-terphenyl; |
| MF | C18H10Cl4 |
| Masie cząsteczkowej | 368.084 |
| InChI | InChI=1/C18H10Cl4/c19-15-13(11-7-3-1-4-8-11)14(12-9-5-2-6-10-12)16(20)18(22)17(15)21/h1-10H |
| Nr CAS | 88384-58-1 |
| Struktury molekularnej | ![]() |
| Gęstość | 1.374g/cm3 |
| Temperatura wrzenia | 410.6°C at 760 mmHg |
| Współczynnik załamania | 1.627 |
| Temperatura zapłonu | 194.7°C |
| Ciśnienie pary | 1.42E-06mmHg at 25°C |
| MSDS | |