ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
103-19-5 p-Tolyl disulfide |
|
| Nome do produto | p-Tolyl disulfide |
| Nome em inglês | p-Tolyl disulfide; |
| Fórmula molecular | C14H14S2 |
| Peso Molecular | 246.391 |
| InChI | InChI=1/C14H14S2/c1-11-3-7-13(8-4-11)15-16-14-9-5-12(2)6-10-14/h3-10H,1-2H3 |
| CAS Registry Number | 103-19-5 |
| EINECS | 203-087-5 |
| Estrutura Molecular | ![]() |
| Densidade | 1.17g/cm3 |
| Ponto de fusão | 43-46℃ |
| Ponto de ebulição | 349.5°C at 760 mmHg |
| índice de refração | 1.649 |
| O ponto de inflamação | 192.6°C |
| Pressão de vapor | 9.46E-05mmHg at 25°C |
| Símbolos de perigo | |
| Códigos de risco | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; |
| MSDS | |