ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
106-70-7 methyl caproate |
|
| Nome do produto | methyl caproate |
| Nome em inglês | methyl caproate;caproic acid methyl ester;methyl capronate;methyl hexanoate;methyl hexylate;methyl n-hexanoate; |
| Fórmula molecular | C7H14O2 |
| Peso Molecular | 130.1849 |
| InChI | InChI=1/C7H14O2/c1-3-4-5-6-7(8)9-2/h3-6H2,1-2H3 |
| CAS Registry Number | 106-70-7 |
| EINECS | 203-425-1 |
| Estrutura Molecular | ![]() |
| Densidade | 0.882g/cm3 |
| Ponto de ebulição | 149.8°C at 760 mmHg |
| índice de refração | 1.406 |
| O ponto de inflamação | 45°C |
| Pressão de vapor | 3.95mmHg at 25°C |
| Códigos de risco | R10:; |
| Descrição da Segurança | S16:; |
| MSDS | |