ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
109971-64-4 3-methoxy-6-[2-(3,4,5-trimethoxyphenyl)ethyl]benzene-1,2-diol |
|
| Nome do produto | 3-methoxy-6-[2-(3,4,5-trimethoxyphenyl)ethyl]benzene-1,2-diol |
| Nome em inglês | 3-methoxy-6-[2-(3,4,5-trimethoxyphenyl)ethyl]benzene-1,2-diol;1,2-Benzenediol, 3-methoxy-6-(2-(3,4,5-trimethoxyphenyl)ethyl)-;1,2-benzenediol, 3-methoxy-6-[2-(3,4,5-trimethoxyphenyl)ethyl]-;3-Methoxy-6-(2-(3,4,5-trimethoxyphenyl)ethyl)-1,2-benzenediol |
| Fórmula molecular | C18H22O6 |
| Peso Molecular | 334.3637 |
| InChI | InChI=1/C18H22O6/c1-21-13-8-7-12(16(19)17(13)20)6-5-11-9-14(22-2)18(24-4)15(10-11)23-3/h7-10,19-20H,5-6H2,1-4H3 |
| CAS Registry Number | 109971-64-4 |
| Estrutura Molecular | ![]() |
| Densidade | 1.212g/cm3 |
| Ponto de ebulição | 475.6°C at 760 mmHg |
| índice de refração | 1.572 |
| O ponto de inflamação | 241.4°C |
| Pressão de vapor | 1.14E-09mmHg at 25°C |
| MSDS | |