ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
216144-37-5 4-(n-butiltio)tioanisole |
|
| Nome do produto | 4-(n-butiltio)tioanisole |
| Nome em inglês | 4-(n-Butylthio)thioanisole; |
| Fórmula molecular | C11H16OS2 |
| Peso Molecular | 228.3741 |
| InChI | InChI=1/C11H16OS2/c1-3-4-9-13-14-11-7-5-10(12-2)6-8-11/h5-8H,3-4,9H2,1-2H3 |
| CAS Registry Number | 216144-37-5 |
| Estrutura Molecular | ![]() |
| índice de refração | 1.57 |
| Descrição da Segurança | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |