ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
4433-30-1 Undecanophenone |
|
| Nome do produto | Undecanophenone |
| Nome em inglês | Undecanophenone;n-Decyl phenyl ketone;1-phenylundecan-2-one |
| Fórmula molecular | C17H26O |
| Peso Molecular | 246.3877 |
| InChI | InChI=1/C17H26O/c1-2-3-4-5-6-7-11-14-17(18)15-16-12-9-8-10-13-16/h8-10,12-13H,2-7,11,14-15H2,1H3 |
| CAS Registry Number | 4433-30-1 |
| EINECS | 224-633-9 |
| Estrutura Molecular | ![]() |
| Densidade | 0.92g/cm3 |
| Ponto de fusão | 28-30℃ |
| Ponto de ebulição | 342.846°C at 760 mmHg |
| índice de refração | 1.49 |
| O ponto de inflamação | 114.968°C |
| Pressão de vapor | 0mmHg at 25°C |
| Descrição da Segurança | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |