ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
451-13-8 2,5-Dihydroxyphenylacetic acid |
|
| Nome do produto | 2,5-Dihydroxyphenylacetic acid |
| Nome em inglês | 2,5-Dihydroxyphenylacetic acid;homogentisic acid free acid;Homogentisic acid 2,5-Dihydroxyphenylacetic acid;Homogentisicacid;Homogentisic acid;(2,5-dihydroxyphenyl)acetate |
| Fórmula molecular | C8H7O4 |
| Peso Molecular | 167.1393 |
| InChI | InChI=1/C8H8O4/c9-6-1-2-7(10)5(3-6)4-8(11)12/h1-3,9-10H,4H2,(H,11,12)/p-1 |
| CAS Registry Number | 451-13-8 |
| EINECS | 207-192-7 |
| Estrutura Molecular | ![]() |
| Ponto de fusão | 147-153℃ |
| Ponto de ebulição | 439.3°C at 760 mmHg |
| O ponto de inflamação | 233.6°C |
| Pressão de vapor | 1.71E-08mmHg at 25°C |
| Descrição da Segurança | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |