ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
453-17-8 D(+)-Glyceraldehyde |
|
| Nome do produto | D(+)-Glyceraldehyde |
| Nome em inglês | D(+)-Glyceraldehyde;D-(+)-Glyceraldehyde;(R)-(+)-2,3-Dihydroxypropanal |
| Fórmula molecular | C3H6O3 |
| Peso Molecular | 90.08 |
| InChI | InChI=1/C3H6O3/c4-1-3(6)2-5/h1,3,5-6H,2H2/t3-/m0/s1 |
| CAS Registry Number | 453-17-8 |
| EINECS | 207-217-1 |
| Estrutura Molecular | ![]() |
| índice de refração | 1.4935-1.4955 |
| Descrição da Segurança | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |