ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 499769-98-1 N'-hidroxi-3-metil-2,4-dioxo-1-fenil-1,2,3,4-tetrahidropirimidina-5-carboximidamida | |
| Nome do produto | N'-hidroxi-3-metil-2,4-dioxo-1-fenil-1,2,3,4-tetrahidropirimidina-5-carboximidamida | 
| Sinônimos | N-hidroxi-3-metil-2,4-dioxo-1-fenil-1,2,3,4-tetrahidropirimida-5-carboximidamida; | 
| Nome em inglês | N'-hydroxy-3-methyl-2,4-dioxo-1-phenyl-1,2,3,4-tetrahydropyrimidine-5-carboximidamide;N-Hydroxy-3-methyl-2,4-dioxo-1-phenyl-1,2,3,4-tetrahydropyrimidine-5-carboximidamid | 
| Fórmula molecular | C12H12N4O3 | 
| Peso Molecular | 260.2487 | 
| InChI | InChI=1/C12H12N4O3/c1-15-11(17)9(10(13)14-19)7-16(12(15)18)8-5-3-2-4-6-8/h2-7,19H,1H3,(H2,13,14) | 
| CAS Registry Number | 499769-98-1 | 
| Estrutura Molecular |  | 
| Densidade | 1.42g/cm3 | 
| Ponto de fusão | 189℃ | 
| Ponto de ebulição | 454.2°C at 760 mmHg | 
| índice de refração | 1.666 | 
| O ponto de inflamação | 228.5°C | 
| Pressão de vapor | 4.86E-09mmHg at 25°C | 
| Símbolos de perigo | |
| Códigos de risco | R36/37/38##Irritating to eyes, respiratory system and skin.:; | 
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S37/39##Wear suitable gloves and eye/face protection.:; | 
| MSDS | |