ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
520-03-6 N-phenylphthalimide |
|
| Nome do produto | N-phenylphthalimide |
| Nome em inglês | N-phenylphthalimide;2-PHENYL-ISOINDOLE-1,3-DIONE;PHTHALANIL;1H-Isoindole-1,3(2H)-dione, 2-phenyl-;1H-Isoindole-1,3(2H)-dione,2-phenyl-;2-Phenyl-1,3-isoindoledione;2-Phenyl-1,3-isoindolinedione;2-Phenyl-1H-isoindole-1,3(2H)-dione;2-phenyl-1h-isoindole-3(2h)-dione;n-phenyl-phthalimid;Phthalimide, N-phenyl-;Phthalimide,N-phenyl-;Phenylphthalimide;N-phenyl phthalimide |
| Fórmula molecular | C14H9NO2 |
| Peso Molecular | 223.2268 |
| InChI | InChI=1/C14H9NO2/c16-13-11-8-4-5-9-12(11)14(17)15(13)10-6-2-1-3-7-10/h1-9H |
| CAS Registry Number | 520-03-6 |
| EINECS | 208-282-9 |
| Estrutura Molecular | ![]() |
| Densidade | 1.338g/cm3 |
| Ponto de fusão | 204-207℃ |
| Ponto de ebulição | 388.8°C at 760 mmHg |
| índice de refração | 1.667 |
| O ponto de inflamação | 182.6°C |
| Pressão de vapor | 2.99E-06mmHg at 25°C |
| Descrição da Segurança | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |