ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5757-88-0 1,1-dimethyl-2-[1-(4-methylphenyl)ethylidene]hydrazine |
|
| Nome do produto | 1,1-dimethyl-2-[1-(4-methylphenyl)ethylidene]hydrazine |
| Nome em inglês | 1,1-dimethyl-2-[1-(4-methylphenyl)ethylidene]hydrazine; |
| Fórmula molecular | C11H16N2 |
| Peso Molecular | 176.2581 |
| InChI | InChI=1/C11H16N2/c1-9-5-7-11(8-6-9)10(2)12-13(3)4/h5-8H,1-4H3 |
| CAS Registry Number | 5757-88-0 |
| Estrutura Molecular | ![]() |
| Densidade | 0.91g/cm3 |
| Ponto de ebulição | 251.1°C at 760 mmHg |
| índice de refração | 1.501 |
| O ponto de inflamação | 105.6°C |
| Pressão de vapor | 0.0209mmHg at 25°C |
| MSDS | |