ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
59188-41-9 4-nitrophenyl 6-{[(benzyloxy)carbonyl]amino}hexanoate |
|
| Nome do produto | 4-nitrophenyl 6-{[(benzyloxy)carbonyl]amino}hexanoate |
| Nome em inglês | 4-nitrophenyl 6-{[(benzyloxy)carbonyl]amino}hexanoate; |
| Fórmula molecular | C20H22N2O6 |
| Peso Molecular | 386.3985 |
| InChI | InChI=1/C20H22N2O6/c23-19(28-18-12-10-17(11-13-18)22(25)26)9-5-2-6-14-21-20(24)27-15-16-7-3-1-4-8-16/h1,3-4,7-8,10-13H,2,5-6,9,14-15H2,(H,21,24) |
| CAS Registry Number | 59188-41-9 |
| Estrutura Molecular | ![]() |
| Densidade | 1.242g/cm3 |
| Ponto de ebulição | 574.9°C at 760 mmHg |
| índice de refração | 1.568 |
| O ponto de inflamação | 301.5°C |
| Pressão de vapor | 3.22E-13mmHg at 25°C |
| MSDS | |