ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
| 729-43-1 Acetophenone Azine | |
| Nome do produto | Acetophenone Azine | 
| Nome em inglês | Acetophenone Azine;Ethanone, 1-phenyl-, 2-(1-phenylethylidene)hydrazone;Acetophenone azine;Ethanone, 1-phenyl-, (1-phenylethylidene)hydrazone;NSC 25772;1-Phenylethan-1-one (1-phenylethylidene)hydrazone;Acetophenone, azine (8CI);bis(1-phenylethylidene)hydrazine;(1Z,2Z)-bis(1-phenylethylidene)hydrazine;(1E,2E)-bis(1-phenylethylidene)hydrazine | 
| Fórmula molecular | C16H16N2 | 
| Peso Molecular | 236.3116 | 
| InChI | InChI=1/C16H16N2/c1-13(15-9-5-3-6-10-15)17-18-14(2)16-11-7-4-8-12-16/h3-12H,1-2H3/b17-13+,18-14+ | 
| CAS Registry Number | 729-43-1 | 
| EINECS | 211-979-0 | 
| Estrutura Molecular |  | 
| Densidade | 0.98g/cm3 | 
| Ponto de ebulição | 333.2°C at 760 mmHg | 
| índice de refração | 1.551 | 
| O ponto de inflamação | 147.4°C | 
| Pressão de vapor | 0.000268mmHg at 25°C | 
| Descrição da Segurança | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; | 
| MSDS | |