ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
76847-45-5 N~5~-(diaminometilideno)-N-(4-nitrofenil)ornitinamida |
|
| Nome do produto | N~5~-(diaminometilideno)-N-(4-nitrofenil)ornitinamida |
| Sinônimos | ; |
| Nome em inglês | N~5~-(diaminomethylidene)-N-(4-nitrophenyl)ornithinamide; |
| Fórmula molecular | C12H18N6O3 |
| Peso Molecular | 294.3097 |
| InChI | InChI=1/C12H18N6O3/c13-10(2-1-7-16-12(14)15)11(19)17-8-3-5-9(6-4-8)18(20)21/h3-6,10H,1-2,7,13H2,(H,17,19)(H4,14,15,16) |
| CAS Registry Number | 76847-45-5 |
| Estrutura Molecular | ![]() |
| Densidade | 1.47g/cm3 |
| índice de refração | 1.659 |
| MSDS | |