ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84-78-6 butyl octyl phthalate |
|
| Nome do produto | butyl octyl phthalate |
| Nome em inglês | butyl octyl phthalate;1,2-Benzenedicarboxylic acid, 1-butyl 2-octyl ester;BRN 2289337;Butyl octyl phthalate;NSC 69894;Octyl butyl phthalate;PX 914;Plasticizer BOP;Plasticizer OBP;Staflex BOP;Truflex OBP;1,2-Benzenedicarboxylic acid, butyl octyl ester;Phthalic acid, butyl octyl ester (6CI,7CI,8CI);butyl octyl benzene-1,2-dicarboxylate |
| Fórmula molecular | C20H30O4 |
| Peso Molecular | 334.4498 |
| InChI | InChI=1/C20H30O4/c1-3-5-7-8-9-12-16-24-20(22)18-14-11-10-13-17(18)19(21)23-15-6-4-2/h10-11,13-14H,3-9,12,15-16H2,1-2H3 |
| CAS Registry Number | 84-78-6 |
| EINECS | 201-562-1 |
| Estrutura Molecular | ![]() |
| Densidade | 1.012g/cm3 |
| Ponto de ebulição | 377.1°C at 760 mmHg |
| índice de refração | 1.493 |
| O ponto de inflamação | 200.1°C |
| Pressão de vapor | 6.93E-06mmHg at 25°C |
| MSDS | |