ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
85-55-2 2-(4-Methylbenzoyl)benzoic acid |
|
| Nome do produto | 2-(4-Methylbenzoyl)benzoic acid |
| Nome em inglês | 2-(4-Methylbenzoyl)benzoic acid;2-(p-Toluoyl)benzoic acid;4-Methylbenzophenone-2-carboxylic acid;2-[(4-methylphenyl)carbonyl]benzoate |
| Fórmula molecular | C15H11O3 |
| Peso Molecular | 239.2466 |
| InChI | InChI=1/C15H12O3/c1-10-6-8-11(9-7-10)14(16)12-4-2-3-5-13(12)15(17)18/h2-9H,1H3,(H,17,18)/p-1 |
| CAS Registry Number | 85-55-2 |
| EINECS | 201-614-3 |
| Estrutura Molecular | ![]() |
| Ponto de fusão | 137-139℃ |
| Ponto de ebulição | 457.1°C at 760 mmHg |
| O ponto de inflamação | 244.3°C |
| Pressão de vapor | 3.79E-09mmHg at 25°C |
| Códigos de risco | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| Descrição da Segurança | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36##Wear suitable protective clothing.:; |
| MSDS | |