ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
879053-77-7 4-(4-metoxi-2,5-dimetilfenil)-1,3-tiazol-2-amina |
|
| Nome do produto | 4-(4-metoxi-2,5-dimetilfenil)-1,3-tiazol-2-amina |
| Sinônimos | 4-(4-metoxi-2,5-dimetilfenil)-2-tiazolamina 4-(4-metoxi-2,5-dimetilfenil)-1,3-tiazol-2-amina; |
| Nome em inglês | 4-(4-methoxy-2,5-dimethylphenyl)-1,3-thiazol-2-amine;2-Thiazolamine, 4-(4-methoxy-2,5-dimethylphenyl)-;4-(4-Methoxy-2,5-dimethylphenyl)-1,3-thiazol-2-amine |
| Fórmula molecular | C12H14N2OS |
| Peso Molecular | 234.3174 |
| InChI | InChI=1/C12H14N2OS/c1-7-5-11(15-3)8(2)4-9(7)10-6-16-12(13)14-10/h4-6H,1-3H3,(H2,13,14) |
| CAS Registry Number | 879053-77-7 |
| Estrutura Molecular | ![]() |
| Densidade | 1.193g/cm3 |
| Ponto de ebulição | 384.4°C at 760 mmHg |
| índice de refração | 1.608 |
| O ponto de inflamação | 186.3°C |
| Pressão de vapor | 4.1E-06mmHg at 25°C |
| MSDS | |