ChemIndex - Um banco de dados CAS químico gratuitoToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
89-04-3 trioctilbenzeno-1,2,4-tricarboxilato |
|
| Nome do produto | trioctilbenzeno-1,2,4-tricarboxilato |
| Sinônimos | Tri-n-octil trimellitato; HSDB 5263; PX 338; Trimex N 08; ácido 1,2,4-benzenotricarboxílico, éster 1,2,4-trioctil; ácido 1,2,4-benzenotricarboxílico, éster trioctil; Trioctilbenzeno-1,2,4-tricarboxilato; Ácido tricarboxílico benzeno, éster trioctil; |
| Nome em inglês | trioctyl benzene-1,2,4-tricarboxylate;Tri-n-octyl trimellitate;HSDB 5263;PX 338;Trimex N 08;1,2,4-Benzenetricarboxylic acid, 1,2,4-trioctyl ester;1,2,4-Benzenetricarboxylic acid, trioctyl ester;Trioctyl benzene-1,2,4-tricarboxylate;Benzene tricarboxylic acid, trioctyl ester |
| Fórmula molecular | C33H54O6 |
| Peso Molecular | 546.7783 |
| InChI | InChI=1/C33H54O6/c1-4-7-10-13-16-19-24-37-31(34)28-22-23-29(32(35)38-25-20-17-14-11-8-5-2)30(27-28)33(36)39-26-21-18-15-12-9-6-3/h22-23,27H,4-21,24-26H2,1-3H3 |
| CAS Registry Number | 89-04-3 |
| EINECS | 201-877-4 |
| Estrutura Molecular | ![]() |
| Densidade | 0.994g/cm3 |
| Ponto de ebulição | 594.8°C at 760 mmHg |
| índice de refração | 1.489 |
| O ponto de inflamação | 242.5°C |
| Pressão de vapor | 4.1E-14mmHg at 25°C |
| MSDS | |