ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
24972-61-0 1,2-ethanediamine, platinum(2+) salt, compd. with 2,2'-bipyridine (1:1:1) |
|
اسم المنتج | 1,2-ethanediamine, platinum(2+) salt, compd. with 2,2'-bipyridine (1:1:1) |
الاسم بالانجليزية | 1,2-ethanediamine, platinum(2+) salt, compd. with 2,2'-bipyridine (1:1:1); |
الصيغة الجزيئية | C12H16N4Pt |
الوزن الجزيئي الغرامي | 411.3651 |
InChI | InChI=1/C10H8N2.C2H8N2.Pt/c1-3-7-11-9(5-1)10-6-2-4-8-12-10;3-1-2-4;/h1-8H;1-4H2;/q;;+2 |
إستراتيجية المساعدة القطرية | 24972-61-0 |
بنية جزيئية | ![]() |
نقطة الغليان | 272.5°C at 760 mmHg |
نقطة الوميض | 107.2°C |
ضغط البخار | 0.0101mmHg at 25°C |
MSDS |