ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
50533-97-6 4-dimethylaminopiperidine |
|
| اسم المنتج | 4-dimethylaminopiperidine |
| الاسم بالانجليزية | 4-dimethylaminopiperidine;4-(Dimethylamino)piperidine;N,N-dimethylpiperidin-4-amine |
| الصيغة الجزيئية | C7H16N2 |
| الوزن الجزيئي الغرامي | 128.2153 |
| InChI | InChI=1/C7H16N2/c1-9(2)7-3-5-8-6-4-7/h7-8H,3-6H2,1-2H3 |
| إستراتيجية المساعدة القطرية | 50533-97-6 |
| المفوضية الأوروبية رقم | 256-617-2 |
| بنية جزيئية | ![]() |
| كثافة | 0.91g/cm3 |
| نقطة الغليان | 179.7°C at 760 mmHg |
| معامل الإنكسار | 1.479 |
| نقطة الوميض | 63.3°C |
| ضغط البخار | 0.929mmHg at 25°C |
| خطر المصطلحات | R10##Flammable.||R34##Causes burns.:; |
| شروط الأمن | S26##In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.||S36/37/39##Wear suitable protective clothing, gloves and eye/face protection.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).:; |
| MSDS | |