ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
54831-91-3 1,2-ethanediamine, platinum(2+) salt, compd. with 1,10-phenanthroline (1:1:1) |
|
اسم المنتج | 1,2-ethanediamine, platinum(2+) salt, compd. with 1,10-phenanthroline (1:1:1) |
الاسم بالانجليزية | 1,2-ethanediamine, platinum(2+) salt, compd. with 1,10-phenanthroline (1:1:1); |
الصيغة الجزيئية | C14H16N4Pt |
الوزن الجزيئي الغرامي | 435.3865 |
InChI | InChI=1/C12H8N2.C2H8N2.Pt/c1-3-9-5-6-10-4-2-8-14-12(10)11(9)13-7-1;3-1-2-4;/h1-8H;1-4H2;/q;;+2 |
إستراتيجية المساعدة القطرية | 54831-91-3 |
بنية جزيئية | ![]() |
نقطة الغليان | 365.1°C at 760 mmHg |
نقطة الوميض | 164.8°C |
ضغط البخار | 3.38E-05mmHg at 25°C |
MSDS |