ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
5617-70-9 cycl-isopropylidene cyclopropane-1,1-dicarboxylate |
|
اسم المنتج | cycl-isopropylidene cyclopropane-1,1-dicarboxylate |
الاسم بالانجليزية | cycl-isopropylidene cyclopropane-1,1-dicarboxylate;6,6-dimethyl-5,7-dioxaspiro(2.5)octane-4,8-dione;1,1-Cyclopropanedicarboxylic acid cycl-isopropylidene ester;cycl-Isopropylidene 1,1-cyclopropanedicarboxylate;6,6-dimethyl-5,7-dioxaspiro[2.5]octane-4,8-dione |
الصيغة الجزيئية | C8H10O4 |
الوزن الجزيئي الغرامي | 170.1626 |
InChI | InChI=1/C8H10O4/c1-7(2)11-5(9)8(3-4-8)6(10)12-7/h3-4H2,1-2H3 |
إستراتيجية المساعدة القطرية | 5617-70-9 |
المفوضية الأوروبية رقم | 227-044-5 |
بنية جزيئية | ![]() |
كثافة | 1.29g/cm3 |
درجة الإنصهار | 65-65℃ |
نقطة الغليان | 396.8°C at 760 mmHg |
معامل الإنكسار | 1.501 |
نقطة الوميض | 215.9°C |
ضغط البخار | 1.66E-06mmHg at 25°C |
شروط الأمن | S22##Do not inhale dust.||S24/25##Avoid contact with skin and eyes.:; |
MSDS |