ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
68130-53-0 Decanoic acid, mixed esters with heptanoic acid, octanoic acid and trimethylolpropane |
|
اسم المنتج | Decanoic acid, mixed esters with heptanoic acid, octanoic acid and trimethylolpropane |
الاسم بالانجليزية | Decanoic acid, mixed esters with heptanoic acid, octanoic acid and trimethylolpropane;Decanoic acid mixed esters with heptanoic acid octanoic acid and trimethylolpropane;Trimethylolpropane, enanthylic acid, caprylic acid, capric acid esters;Trimethylolpropane, esters with (C7, C8, C10)saturated straight-chain fatty acids;Trimethylolpropane, heptanoic acid, caprylic acid, capric acid mixed esters;Decanoic acid, mixed esters with heptanoic acid, octanoic acid andtrimethylolpropane;3-(heptanoyloxy)-2-(octanoyloxy)propyl dodecanoate |
الصيغة الجزيئية | C30H56O6 |
الوزن الجزيئي الغرامي | 512.762 |
InChI | InChI=1/C30H56O6/c1-4-7-10-13-14-15-16-18-20-23-29(32)35-26-27(25-34-28(31)22-19-12-9-6-3)36-30(33)24-21-17-11-8-5-2/h27H,4-26H2,1-3H3 |
إستراتيجية المساعدة القطرية | 68130-53-0 |
المفوضية الأوروبية رقم | 268-596-7 |
بنية جزيئية | ![]() |
كثافة | 0.959g/cm3 |
نقطة الغليان | 544.1°C at 760 mmHg |
معامل الإنكسار | 1.459 |
نقطة الوميض | 221.8°C |
ضغط البخار | 6.71E-12mmHg at 25°C |
MSDS |