ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
84373-12-6 3',6'-bis[(2-ethyl-6-methylphenyl)amino]spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one |
|
| اسم المنتج | 3',6'-bis[(2-ethyl-6-methylphenyl)amino]spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one |
| الاسم بالانجليزية | 3',6'-bis[(2-ethyl-6-methylphenyl)amino]spiro[isobenzofuran-1(3H),9'-[9H]xanthene]-3-one;3',6'-Bis((2-ethyl-6-methylphenyl)amino)spiro(isobenzofuran-1(3H),9'-(9H)xanthene)-3-one;3',6'-bis[(2-ethyl-6-methyl-phenyl)amino]spiro[isobenzofuran-3,9'-xanthene]-1-one |
| الصيغة الجزيئية | C38H34N2O3 |
| الوزن الجزيئي الغرامي | 566.6882 |
| InChI | InChI=1/C38H34N2O3/c1-5-25-13-9-11-23(3)35(25)39-27-17-19-31-33(21-27)42-34-22-28(40-36-24(4)12-10-14-26(36)6-2)18-20-32(34)38(31)30-16-8-7-15-29(30)37(41)43-38/h7-22,39-40H,5-6H2,1-4H3 |
| إستراتيجية المساعدة القطرية | 84373-12-6 |
| المفوضية الأوروبية رقم | 282-750-0 |
| بنية جزيئية | ![]() |
| كثافة | 1.28g/cm3 |
| نقطة الغليان | 695.3°C at 760 mmHg |
| معامل الإنكسار | 1.697 |
| نقطة الوميض | 374.3°C |
| ضغط البخار | 3.49E-19mmHg at 25°C |
| MSDS | |