ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
87-88-7 Chloranilic acid |
|
| اسم المنتج | Chloranilic acid |
| الاسم بالانجليزية | Chloranilic acid;2,5-Dichloro-3,6-Dihydroxy-P-Quinone;2,5-Dichloro-3,6-Dihydroxyquinone;2,5-Dichloro-3,6-Dihydroxy-P-Benzoquinone;Labotest-Bb Lt00159487;Timtec-Bb Sbb008913;2,5-Cyclohexadiene-1,4-Dione, 2,5-Dichloro-3,6-Dihydroxy-;2,5-Cyclohexadiene-1,4-Dione,2,5-Dichloro-3,6-Dihydroxy-;2,5-Dichloro-3,6-Dihydroxybenzo-1,4-Quinone;2,5-Dichloro-3,6-Dihydroxy-P-Benzoquinon;2,5-Dichloro-3,6-Dihydroxy-P-Quinon;2,5-Dihydroxy-3,6-Dichlorobenzoquinone;4-Dione,2,5-Dichloro-3,6-Dihydroxy-5-Cyclohexadiene-1;5-Cyclohexadiene-1,4-Dione,2,5-Dichloro-3,6-Dihydroxy-2;Chloranilic;P-Benzoquinone, 2,5-Dichloro-3,6-Dihydroxy-;P-Chloranilicacid;2,5-Dichloro-3,6-Dihydroxybenzoquinone;Chloranilic Acid Crystalline;2,5-Dyhydroxy-3,6-2-Benzoquinone;2,5-Dochloro-3,6-Dyhydroxybenzoquinone;Chlorobenzene Acid;2,5-Dochloro-3,6-Dohydroxy-P-Benzoquinone;2,5-Dochloro-3,6-Dihydroxy Benzoquinone;Dichloro Hydroquinone;2,5-Dichloro-3,6-Dihydroxy-1,4-Benzoquinone;Chloranilic Acid,(2,5-Dichloro-3,6-Dihydroxy-1,4;2,5-dichloro-3,6-dihydroxycyclohexa-2,5-diene-1,4-dione |
| الصيغة الجزيئية | C6H2Cl2O4 |
| الوزن الجزيئي الغرامي | 208.9837 |
| InChI | InChI=1/C6H2Cl2O4/c7-1-3(9)5(11)2(8)6(12)4(1)10/h9,12H |
| إستراتيجية المساعدة القطرية | 87-88-7 |
| المفوضية الأوروبية رقم | 201-780-7 |
| بنية جزيئية | ![]() |
| كثافة | 1.93g/cm3 |
| درجة الإنصهار | 282-284℃ |
| نقطة الغليان | 300.3°C at 760 mmHg |
| معامل الإنكسار | 1.654 |
| نقطة الوميض | 135.4°C |
| ضغط البخار | 0.000111mmHg at 25°C |
| علامات على البضائع الخطرة | |
| خطر المصطلحات | R36/37/38##Irritating to eyes, respiratory system and skin.:; |
| شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |