ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
886362-68-1 4-Fluoro-2-methylindole-3-carboxylic acid ethyl ester |
|
| اسم المنتج | 4-Fluoro-2-methylindole-3-carboxylic acid ethyl ester |
| الاسم بالانجليزية | 4-Fluoro-2-methylindole-3-carboxylic acid ethyl ester;1H-Indole-3-carboxylic acid, 4-fluoro-2-methyl-, ethyl ester;Ethyl 4-fluoro-2-methyl-1H-indole-3-carboxylate;4-Fluoro-2-methlindole-3-carboxylic acid ethyl ester |
| الصيغة الجزيئية | C12H12FNO2 |
| الوزن الجزيئي الغرامي | 221.2276 |
| InChI | InChI=1/C12H12FNO2/c1-3-16-12(15)10-7(2)14-9-6-4-5-8(13)11(9)10/h4-6,14H,3H2,1-2H3 |
| إستراتيجية المساعدة القطرية | 886362-68-1 |
| بنية جزيئية | ![]() |
| كثافة | 1.251g/cm3 |
| نقطة الغليان | 347.6°C at 760 mmHg |
| معامل الإنكسار | 1.591 |
| نقطة الوميض | 164°C |
| ضغط البخار | 5.32E-05mmHg at 25°C |
| MSDS | |