ChemIndex - قاعدة بيانات CAS كيميائية مجانيةToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
94-16-6 4-Aminohippuric acid, sodium salt monohydrate |
|
| اسم المنتج | 4-Aminohippuric acid, sodium salt monohydrate |
| الاسم بالانجليزية | 4-Aminohippuric acid, sodium salt monohydrate;4-Aminohippuric acid sodium salt hydrate;Sodium 4-aminohippurate hydrate;Aminohippurate Sodium;sodium [(4-aminobenzoyl)amino]acetate |
| الصيغة الجزيئية | C9H9N2NaO3 |
| الوزن الجزيئي الغرامي | 216.1691 |
| InChI | InChI=1/C9H10N2O3.Na/c10-7-3-1-6(2-4-7)9(14)11-5-8(12)13;/h1-4H,5,10H2,(H,11,14)(H,12,13);/q;+1/p-1 |
| إستراتيجية المساعدة القطرية | 94-16-6 |
| المفوضية الأوروبية رقم | 202-309-8 |
| بنية جزيئية | ![]() |
| درجة الإنصهار | 123-125℃ |
| نقطة الغليان | 517.2°C at 760 mmHg |
| نقطة الوميض | 266.6°C |
| ضغط البخار | 1.6E-11mmHg at 25°C |
| شروط الأمن | S24/25##Avoid contact with skin and eyes.:; |
| MSDS | |