ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
202823-24-3 (5-kloro-2-metoksifenil) hidrazin |
|
| Ürün Adı | (5-kloro-2-metoksifenil) hidrazin |
| Eş anlamlı | ; hidrazin, (5-kloro-2-metoksifenil)-; 5-Kloro-2-metoksifenilhidrazin hidroklorür; 5-Kloro-2-metoksifenilhidrazin hidroklorür; |
| ingilizce adı | (5-chloro-2-methoxyphenyl)hydrazine;hydrazine, (5-chloro-2-methoxyphenyl)-;5-Chloro-2-Methoxyphenylhydrazine Hydrochloride;5-Chloro-2-Methoxyphenylhydrazine Hydrochloride |
| Moleküler Formülü | C7H9ClN2O |
| Molekül Ağırlığı | 172.6122 |
| InChI | InChI=1/C7H9ClN2O/c1-11-7-3-2-5(8)4-6(7)10-9/h2-4,10H,9H2,1H3 |
| CAS kayıt numarası | 202823-24-3;5446-16-2 |
| Moleküler Yapısı | ![]() |
| Yoğunluk | 1.307g/cm3 |
| Kaynama noktası | 285.7°C at 760 mmHg |
| Kırılma indisi | 1.619 |
| Alevlenme noktası | 126.6°C |
| Buhar basıncı | 0.00275mmHg at 25°C |
| MSDS | |