ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
306-37-6 sym-Dimethylhydrazine dihydrochloride |
|
| Ürün Adı | sym-Dimethylhydrazine dihydrochloride |
| ingilizce adı | sym-Dimethylhydrazine dihydrochloride;1,2-Dimethylhydrazine dihydrochloride;1,2-dimethylhydrazine;1,1-dimethylhydrazine dihydrochloride |
| Moleküler Formülü | C2H10Cl2N2 |
| Molekül Ağırlığı | 133.0202 |
| InChI | InChI=1/C2H8N2.2ClH/c1-4(2)3;;/h3H2,1-2H3;2*1H |
| CAS kayıt numarası | 306-37-6 |
| EINECS | 206-183-5 |
| Moleküler Yapısı | ![]() |
| Ergime noktası | 166-167℃ |
| Kaynama noktası | 63.9°C at 760 mmHg |
| Alevlenme noktası | 1.1°C |
| Buhar basıncı | 168mmHg at 25°C |
| Tehlike Sembolleri | |
| Risk Kodları | R23/24/25##Toxic by inhalation, in contact with skin and if swallowed.||R45##May cause cancer.:; |
| Güvenlik Açıklaması | S24/25##Avoid contact with skin and eyes.||S45##In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).||S53##Avoid exposure - obtain special instructions before use.:; |
| MSDS | |