ChemIndex - Ücretsiz bir kimyasal CAS veritabanıToocle Global|ChemNet Global|ChemNet China|China Chemical Network|ChemNet Korea
380228-57-9 3',5'-dichlorobiphenyl-3-carboxylate |
|
| Ürün Adı | 3',5'-dichlorobiphenyl-3-carboxylate |
| ingilizce adı | 3',5'-dichlorobiphenyl-3-carboxylate; |
| Moleküler Formülü | C13H7Cl2O2 |
| Molekül Ağırlığı | 266.1 |
| InChI | InChI=1/C13H8Cl2O2/c14-11-5-10(6-12(15)7-11)8-2-1-3-9(4-8)13(16)17/h1-7H,(H,16,17)/p-1 |
| CAS kayıt numarası | 380228-57-9 |
| Moleküler Yapısı | ![]() |
| Kaynama noktası | 448°C at 760 mmHg |
| Alevlenme noktası | 224.7°C |
| Buhar basıncı | 8.24E-09mmHg at 25°C |
| MSDS | |